What is Cinnamyl valerate?
Cinnamyl valerate is a natural product found in Bupleurum fruticosum with data available. LOTUS – the natural products occurrence database.
What is Cinnamyl acetate used for?
Cinnamyl acetate is used as a flavour ester in for example bread and animal feed and has a sweet floral-fruity fragrance. Moreover, it is used in several cosmetics, some toiletries but also in non-cosmetic products, for example detergents.
What is the Iupac name of cinnamic acid?
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
|---|---|
| Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.161 g/mol |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
What is cinnamic acid used for?
trans-Cinnamic acid is used in the manufacture of flavors, dyes, and pharmaceuticals; but its major use is for the production of its methyl, ethyl, and benzyl esters. These esters are important components of perfumes. The acid is also a precursor to the sweetener aspartame.
What is cinnamic acid derivatives?
The common cinnamic acid derivatives include p-coumaric acid, caffeic acid, and ferulic acid. Chokeberry is abundant in hydroxycinnamic acid derivatives represented mainly by chlorogenic acid and neochlorogenic acid. Ellagic acid and its conjugates form the majority of phenolic acids in red raspberries.
What foods contain cinnamic acid?
In addition, cinnamic acid can be generally obtained from cinnamon (Cinnamomum cassia (L.) J. Presl), citrus fruits, grape (Vitis vinifera L.), tea (Camellia sinensis (L.) Kuntze), cocoa (Theobroma cacao L.), spinach (Spinacia oleracea L.), celery (Apium graveolens L.), and brassicas vegetables [18].
Is cinnamic acid a food preservative?
Cinnamic acid (C9H8O2) is an organic acid isolated from cinnamon bark and generally used as a common food additive being antimicrobial against common postharvest pathogen such.
How do you synthesize cinnamic acid?
Cinnamic acid was synthesized using Perkin reaction by reacting 0.05 mole of benzaldehyde with 0.073 mole of acetic acid anhydride and 0.03 mole of sodium acetate as a catalyst in the Erlenmeyer flask and then the mixture was put in a sonicator for 60 minutes at 70 oC.
Is cinnamic acid found in cinnamon?
Cinnamic acid is naturally found in the spice cinnamon, which is derived from the bark of trees from the genus Cinnamomum. The main aromatic compound responsible for the flavor of cinnamon is cinnamyl aldehyde.
Is cinnamic acid environmentally friendly?
In conclusion, trans-cinnamic acid can be used as an environmentally friendly alternative additive to prevent and control primarily A. sobria, as well as other pathogenic bacteria such as A.
What is the synthesis of aspirin?
Aspirin is prepared by chemical synthesis from salicylic acid, through acetylation with acetic anhydride. The molecular weight of aspirin is 180.16g/mol. It is odourless, colourless to white crystals or crystalline powder.
What are the side effects of aspirin?
severe nausea, vomiting, or stomach pain; bloody or tarry stools, coughing up blood or vomit that looks like coffee grounds; fever lasting longer than 3 days; or. swelling, or pain lasting longer than 10 days….Common side effects of aspirin may include:
- upset stomach;
- heartburn;
- drowsiness; or.
- mild headache.